C33H29NO10 — CID 98364352
[7-[(7-hydroxy-8-methyl-2-oxochromen-4-yl)methoxy]-8-methyl-2-oxochromen-4-yl]methyl 3-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoate (PubChem CID 98364352) has the molecular formula C33H29NO10 and a molecular weight of 599.59 g/mol. Its IUPAC name is [7-[(7-hydroxy-8-methyl-2-oxochromen-4-yl)methoxy]-8-methyl-2-oxochromen-4-yl]methyl 3-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoate.
| Compound Name | [7-[(7-hydroxy-8-methyl-2-oxochromen-4-yl)methoxy]-8-methyl-2-oxochromen-4-yl]methyl 3-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoate |
|---|---|
| PubChem CID | 98364352 |
| Molecular Formula | C33H29NO10 |
| Molecular Weight | 599.59 g/mol |
| Exact Mass | 599.18 |
| IUPAC Name | [7-[(7-hydroxy-8-methyl-2-oxochromen-4-yl)methoxy]-8-methyl-2-oxochromen-4-yl]methyl 3-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoate |
| SMILES | Cc1c(O)ccc2c(COc3ccc4c(COC(=O)CCN5C(=O)[C@@H]6CC=CC[C@H]6C5=O)cc(=O)oc4c3C)cc(=O)oc12 |
| InChI | InChI=1S/C33H29NO10/c1-17-25(35)9-7-21-19(13-28(37)43-30(17)21)15-41-26-10-8-22-20(14-29(38)44-31(22)18(26)2)16-42-27(36)11-12-34-32(39)23-5-3-4-6-24(23)33(34)40/h3-4,7-10,13-14,23-24,35H,5-6,11-12,15-16H2,1-2H3/t23-,24-/m1/s1 |
| InChIKey | OMROAPNTSJQIDZ-DNQXCXABSA-N |
| XLogP | 4.19 |
| TPSA | 153.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.59 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|