C21H26O5 — CID 18287365
(7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl 4-cyclohexylbutanoate (PubChem CID 18287365) has the molecular formula C21H26O5 and a molecular weight of 358.43 g/mol. Its IUPAC name is (7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl 4-cyclohexylbutanoate.
| Compound Name | (7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl 4-cyclohexylbutanoate |
|---|---|
| PubChem CID | 18287365 |
| Molecular Formula | C21H26O5 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | (7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl 4-cyclohexylbutanoate |
| SMILES | Cc1c(O)ccc2c(COC(=O)CCCC3CCCCC3)cc(=O)oc12 |
| InChI | InChI=1S/C21H26O5/c1-14-18(22)11-10-17-16(12-20(24)26-21(14)17)13-25-19(23)9-5-8-15-6-3-2-4-7-15/h10-12,15,22H,2-9,13H2,1H3 |
| InChIKey | IYDLXTNZLKCVFF-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|