C17H20O4 — CID 54704163
7-(cyclohexylmethoxy)-4-hydroxy-8-methylchromen-2-one (PubChem CID 54704163) has the molecular formula C17H20O4 and a molecular weight of 288.34 g/mol. Its IUPAC name is 7-(cyclohexylmethoxy)-4-hydroxy-8-methylchromen-2-one.
| Compound Name | 7-(cyclohexylmethoxy)-4-hydroxy-8-methylchromen-2-one |
|---|---|
| PubChem CID | 54704163 |
| Molecular Formula | C17H20O4 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 7-(cyclohexylmethoxy)-4-hydroxy-8-methylchromen-2-one |
| SMILES | Cc1c(OCC2CCCCC2)ccc2c(O)cc(=O)oc12 |
| InChI | InChI=1S/C17H20O4/c1-11-15(20-10-12-5-3-2-4-6-12)8-7-13-14(18)9-16(19)21-17(11)13/h7-9,12,18H,2-6,10H2,1H3 |
| InChIKey | OYEPHPWONGQTKV-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|