C17H21NO4 — CID 54718831
4-hydroxy-8-methyl-7-[(1-methylpiperidin-3-yl)methoxy]chromen-2-one (PubChem CID 54718831) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is 4-hydroxy-8-methyl-7-[(1-methylpiperidin-3-yl)methoxy]chromen-2-one.
| Compound Name | 4-hydroxy-8-methyl-7-[(1-methylpiperidin-3-yl)methoxy]chromen-2-one |
|---|---|
| PubChem CID | 54718831 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 4-hydroxy-8-methyl-7-[(1-methylpiperidin-3-yl)methoxy]chromen-2-one |
| SMILES | Cc1c(OCC2CCCN(C)C2)ccc2c(O)cc(=O)oc12 |
| InChI | InChI=1S/C17H21NO4/c1-11-15(21-10-12-4-3-7-18(2)9-12)6-5-13-14(19)8-16(20)22-17(11)13/h5-6,8,12,19H,3-4,7,9-10H2,1-2H3 |
| InChIKey | BFJUGQPKIKYAOW-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|