C42H40N2O8 — CID 146335227
7,8-dihydroxy-2-[4-[3-[[8-methoxy-4-oxo-2-(4-piperidin-1-ylphenyl)chromen-7-yl]oxymethyl]piperidin-1-yl]phenyl]chromen-4-one (PubChem CID 146335227) has the molecular formula C42H40N2O8 and a molecular weight of 700.79 g/mol. Its IUPAC name is 7,8-dihydroxy-2-[4-[3-[[8-methoxy-4-oxo-2-(4-piperidin-1-ylphenyl)chromen-7-yl]oxymethyl]piperidin-1-yl]phenyl]chromen-4-one.
| Compound Name | 7,8-dihydroxy-2-[4-[3-[[8-methoxy-4-oxo-2-(4-piperidin-1-ylphenyl)chromen-7-yl]oxymethyl]piperidin-1-yl]phenyl]chromen-4-one |
|---|---|
| PubChem CID | 146335227 |
| Molecular Formula | C42H40N2O8 |
| Molecular Weight | 700.79 g/mol |
| Exact Mass | 700.28 |
| IUPAC Name | 7,8-dihydroxy-2-[4-[3-[[8-methoxy-4-oxo-2-(4-piperidin-1-ylphenyl)chromen-7-yl]oxymethyl]piperidin-1-yl]phenyl]chromen-4-one |
| SMILES | COc1c(OCC2CCCN(c3ccc(-c4cc(=O)c5ccc(O)c(O)c5o4)cc3)C2)ccc2c(=O)cc(-c3ccc(N4CCCCC4)cc3)oc12 |
| InChI | InChI=1S/C42H40N2O8/c1-49-42-36(18-16-32-35(47)23-38(52-41(32)42)28-7-11-29(12-8-28)43-19-3-2-4-20-43)50-25-26-6-5-21-44(24-26)30-13-9-27(10-14-30)37-22-34(46)31-15-17-33(45)39(48)40(31)51-37/h7-18,22-23,26,45,48H,2-6,19-21,24-25H2,1H3 |
| InChIKey | RFJCSEXYWSNYNS-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 125.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.79 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|