C23H27N3O4 — CID 164861250
7,8-dihydroxy-2-[4-[methyl-[2-(4-methylpiperazin-1-yl)ethyl]amino]phenyl]chromen-4-one (PubChem CID 164861250) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is 7,8-dihydroxy-2-[4-[methyl-[2-(4-methylpiperazin-1-yl)ethyl]amino]phenyl]chromen-4-one.
| Compound Name | 7,8-dihydroxy-2-[4-[methyl-[2-(4-methylpiperazin-1-yl)ethyl]amino]phenyl]chromen-4-one |
|---|---|
| PubChem CID | 164861250 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | 7,8-dihydroxy-2-[4-[methyl-[2-(4-methylpiperazin-1-yl)ethyl]amino]phenyl]chromen-4-one |
| SMILES | CN1CCN(CCN(C)c2ccc(-c3cc(=O)c4ccc(O)c(O)c4o3)cc2)CC1 |
| InChI | InChI=1S/C23H27N3O4/c1-24-9-12-26(13-10-24)14-11-25(2)17-5-3-16(4-6-17)21-15-20(28)18-7-8-19(27)22(29)23(18)30-21/h3-8,15,27,29H,9-14H2,1-2H3 |
| InChIKey | DXPYBPIVHXIXIY-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|