C36H45N3O4 — CID 171546153
2-[4-[4-[2-(1-benzylpiperidin-4-yl)ethyl-methylamino]butyl-methylamino]phenyl]-7-hydroxy-8-methoxychromen-4-one (PubChem CID 171546153) has the molecular formula C36H45N3O4 and a molecular weight of 583.77 g/mol. Its IUPAC name is 2-[4-[4-[2-(1-benzylpiperidin-4-yl)ethyl-methylamino]butyl-methylamino]phenyl]-7-hydroxy-8-methoxychromen-4-one.
| Compound Name | 2-[4-[4-[2-(1-benzylpiperidin-4-yl)ethyl-methylamino]butyl-methylamino]phenyl]-7-hydroxy-8-methoxychromen-4-one |
|---|---|
| PubChem CID | 171546153 |
| Molecular Formula | C36H45N3O4 |
| Molecular Weight | 583.77 g/mol |
| Exact Mass | 583.34 |
| IUPAC Name | 2-[4-[4-[2-(1-benzylpiperidin-4-yl)ethyl-methylamino]butyl-methylamino]phenyl]-7-hydroxy-8-methoxychromen-4-one |
| SMILES | COc1c(O)ccc2c(=O)cc(-c3ccc(N(C)CCCCN(C)CCC4CCN(Cc5ccccc5)CC4)cc3)oc12 |
| InChI | InChI=1S/C36H45N3O4/c1-37(22-17-27-18-23-39(24-19-27)26-28-9-5-4-6-10-28)20-7-8-21-38(2)30-13-11-29(12-14-30)34-25-33(41)31-15-16-32(40)36(42-3)35(31)43-34/h4-6,9-16,25,27,40H,7-8,17-24,26H2,1-3H3 |
| InChIKey | LGYTVUFOQXJLRU-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.77 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|