C36H45N3O5 — CID 164861320
2-[4-[4-[2-(1-benzylpiperidin-4-yl)ethyl-methylamino]butyl-methylamino]phenyl]-3,7-dihydroxy-8-methoxychromen-4-one (PubChem CID 164861320) has the molecular formula C36H45N3O5 and a molecular weight of 599.77 g/mol. Its IUPAC name is 2-[4-[4-[2-(1-benzylpiperidin-4-yl)ethyl-methylamino]butyl-methylamino]phenyl]-3,7-dihydroxy-8-methoxychromen-4-one.
| Compound Name | 2-[4-[4-[2-(1-benzylpiperidin-4-yl)ethyl-methylamino]butyl-methylamino]phenyl]-3,7-dihydroxy-8-methoxychromen-4-one |
|---|---|
| PubChem CID | 164861320 |
| Molecular Formula | C36H45N3O5 |
| Molecular Weight | 599.77 g/mol |
| Exact Mass | 599.34 |
| IUPAC Name | 2-[4-[4-[2-(1-benzylpiperidin-4-yl)ethyl-methylamino]butyl-methylamino]phenyl]-3,7-dihydroxy-8-methoxychromen-4-one |
| SMILES | COc1c(O)ccc2c(=O)c(O)c(-c3ccc(N(C)CCCCN(C)CCC4CCN(Cc5ccccc5)CC4)cc3)oc12 |
| InChI | InChI=1S/C36H45N3O5/c1-37(22-17-26-18-23-39(24-19-26)25-27-9-5-4-6-10-27)20-7-8-21-38(2)29-13-11-28(12-14-29)34-33(42)32(41)30-15-16-31(40)36(43-3)35(30)44-34/h4-6,9-16,26,40,42H,7-8,17-25H2,1-3H3 |
| InChIKey | OFVGLDMXZDWEGH-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.77 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|