C20H21O5P — CID 164597648
3,7-dihydroxy-8-methoxy-2-[4-(4-phosphanylbutyl)phenyl]chromen-4-one (PubChem CID 164597648) has the molecular formula C20H21O5P and a molecular weight of 372.36 g/mol. Its IUPAC name is 3,7-dihydroxy-8-methoxy-2-[4-(4-phosphanylbutyl)phenyl]chromen-4-one.
| Compound Name | 3,7-dihydroxy-8-methoxy-2-[4-(4-phosphanylbutyl)phenyl]chromen-4-one |
|---|---|
| PubChem CID | 164597648 |
| Molecular Formula | C20H21O5P |
| Molecular Weight | 372.36 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 3,7-dihydroxy-8-methoxy-2-[4-(4-phosphanylbutyl)phenyl]chromen-4-one |
| SMILES | COc1c(O)ccc2c(=O)c(O)c(-c3ccc(CCCCP)cc3)oc12 |
| InChI | InChI=1S/C20H21O5P/c1-24-20-15(21)10-9-14-16(22)17(23)18(25-19(14)20)13-7-5-12(6-8-13)4-2-3-11-26/h5-10,21,23H,2-4,11,26H2,1H3 |
| InChIKey | WNQZKUGQUQFXBL-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.36 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|