C23H26O6 — CID 123768605
7-hexyl-3-hydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)chromen-4-one (PubChem CID 123768605) has the molecular formula C23H26O6 and a molecular weight of 398.46 g/mol. Its IUPAC name is 7-hexyl-3-hydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)chromen-4-one.
| Compound Name | 7-hexyl-3-hydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)chromen-4-one |
|---|---|
| PubChem CID | 123768605 |
| Molecular Formula | C23H26O6 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 7-hexyl-3-hydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)chromen-4-one |
| SMILES | CCCCCCc1ccc2c(=O)c(O)c(-c3cc(OC)c(O)c(OC)c3)oc2c1 |
| InChI | InChI=1S/C23H26O6/c1-4-5-6-7-8-14-9-10-16-17(11-14)29-23(22(26)20(16)24)15-12-18(27-2)21(25)19(13-15)28-3/h9-13,25-26H,4-8H2,1-3H3 |
| InChIKey | DYBDNXBXBUOTNL-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|