C28H36O6 — CID 89140119
3-butoxy-7-(4-methylpentyl)-2-(3,4,5-trimethoxyphenyl)chromen-4-one (PubChem CID 89140119) has the molecular formula C28H36O6 and a molecular weight of 468.59 g/mol. Its IUPAC name is 3-butoxy-7-(4-methylpentyl)-2-(3,4,5-trimethoxyphenyl)chromen-4-one.
| Compound Name | 3-butoxy-7-(4-methylpentyl)-2-(3,4,5-trimethoxyphenyl)chromen-4-one |
|---|---|
| PubChem CID | 89140119 |
| Molecular Formula | C28H36O6 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | 3-butoxy-7-(4-methylpentyl)-2-(3,4,5-trimethoxyphenyl)chromen-4-one |
| SMILES | CCCCOc1c(-c2cc(OC)c(OC)c(OC)c2)oc2cc(CCCC(C)C)ccc2c1=O |
| InChI | InChI=1S/C28H36O6/c1-7-8-14-33-28-25(29)21-13-12-19(11-9-10-18(2)3)15-22(21)34-26(28)20-16-23(30-4)27(32-6)24(17-20)31-5/h12-13,15-18H,7-11,14H2,1-6H3 |
| InChIKey | MFMHEXIZJVLWHG-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 67.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|