C29H30O6 — CID 20999846
2-(3,4-dimethoxyphenyl)-3-[2-(3,5-dimethylphenoxy)ethoxy]-6,7-dimethylchromen-4-one (PubChem CID 20999846) has the molecular formula C29H30O6 and a molecular weight of 474.55 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-3-[2-(3,5-dimethylphenoxy)ethoxy]-6,7-dimethylchromen-4-one.
| Compound Name | 2-(3,4-dimethoxyphenyl)-3-[2-(3,5-dimethylphenoxy)ethoxy]-6,7-dimethylchromen-4-one |
|---|---|
| PubChem CID | 20999846 |
| Molecular Formula | C29H30O6 |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-3-[2-(3,5-dimethylphenoxy)ethoxy]-6,7-dimethylchromen-4-one |
| SMILES | COc1ccc(-c2oc3cc(C)c(C)cc3c(=O)c2OCCOc2cc(C)cc(C)c2)cc1OC |
| InChI | InChI=1S/C29H30O6/c1-17-11-18(2)13-22(12-17)33-9-10-34-29-27(30)23-14-19(3)20(4)15-25(23)35-28(29)21-7-8-24(31-5)26(16-21)32-6/h7-8,11-16H,9-10H2,1-6H3 |
| InChIKey | AZHZZKYYJVMXFZ-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 67.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|