C26H22O6 — CID 20999830
[2-(3,4-dimethoxyphenyl)-6,7-dimethyl-4-oxochromen-3-yl] benzoate (PubChem CID 20999830) has the molecular formula C26H22O6 and a molecular weight of 430.46 g/mol. Its IUPAC name is [2-(3,4-dimethoxyphenyl)-6,7-dimethyl-4-oxochromen-3-yl] benzoate.
| Compound Name | [2-(3,4-dimethoxyphenyl)-6,7-dimethyl-4-oxochromen-3-yl] benzoate |
|---|---|
| PubChem CID | 20999830 |
| Molecular Formula | C26H22O6 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | [2-(3,4-dimethoxyphenyl)-6,7-dimethyl-4-oxochromen-3-yl] benzoate |
| SMILES | COc1ccc(-c2oc3cc(C)c(C)cc3c(=O)c2OC(=O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C26H22O6/c1-15-12-19-21(13-16(15)2)31-24(18-10-11-20(29-3)22(14-18)30-4)25(23(19)27)32-26(28)17-8-6-5-7-9-17/h5-14H,1-4H3 |
| InChIKey | URKIKWWHWHIPPQ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |