C22H16O5 — CID 20999926
[2-(furan-2-yl)-6,7-dimethyl-4-oxochromen-3-yl] benzoate (PubChem CID 20999926) has the molecular formula C22H16O5 and a molecular weight of 360.37 g/mol. Its IUPAC name is [2-(furan-2-yl)-6,7-dimethyl-4-oxochromen-3-yl] benzoate.
| Compound Name | [2-(furan-2-yl)-6,7-dimethyl-4-oxochromen-3-yl] benzoate |
|---|---|
| PubChem CID | 20999926 |
| Molecular Formula | C22H16O5 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | [2-(furan-2-yl)-6,7-dimethyl-4-oxochromen-3-yl] benzoate |
| SMILES | Cc1cc2oc(-c3ccco3)c(OC(=O)c3ccccc3)c(=O)c2cc1C |
| InChI | InChI=1S/C22H16O5/c1-13-11-16-18(12-14(13)2)26-20(17-9-6-10-25-17)21(19(16)23)27-22(24)15-7-4-3-5-8-15/h3-12H,1-2H3 |
| InChIKey | CETGYOYSBUFERF-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 69.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |