C25H20O5 — CID 7742740
[2-(4-methoxyphenyl)-6,7-dimethyl-4-oxochromen-3-yl] benzoate (PubChem CID 7742740) has the molecular formula C25H20O5 and a molecular weight of 400.43 g/mol. Its IUPAC name is [2-(4-methoxyphenyl)-6,7-dimethyl-4-oxochromen-3-yl] benzoate.
| Compound Name | [2-(4-methoxyphenyl)-6,7-dimethyl-4-oxochromen-3-yl] benzoate |
|---|---|
| PubChem CID | 7742740 |
| Molecular Formula | C25H20O5 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | [2-(4-methoxyphenyl)-6,7-dimethyl-4-oxochromen-3-yl] benzoate |
| SMILES | COc1ccc(-c2oc3cc(C)c(C)cc3c(=O)c2OC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H20O5/c1-15-13-20-21(14-16(15)2)29-23(17-9-11-19(28-3)12-10-17)24(22(20)26)30-25(27)18-7-5-4-6-8-18/h4-14H,1-3H3 |
| InChIKey | YHXKIZFSXVENCT-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |