C25H19NO6 — CID 20999475
[6,7-dimethyl-2-(4-methylphenyl)-4-oxochromen-3-yl] 4-nitrobenzoate (PubChem CID 20999475) has the molecular formula C25H19NO6 and a molecular weight of 429.43 g/mol. Its IUPAC name is [6,7-dimethyl-2-(4-methylphenyl)-4-oxochromen-3-yl] 4-nitrobenzoate.
| Compound Name | [6,7-dimethyl-2-(4-methylphenyl)-4-oxochromen-3-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 20999475 |
| Molecular Formula | C25H19NO6 |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | [6,7-dimethyl-2-(4-methylphenyl)-4-oxochromen-3-yl] 4-nitrobenzoate |
| SMILES | Cc1ccc(-c2oc3cc(C)c(C)cc3c(=O)c2OC(=O)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C25H19NO6/c1-14-4-6-17(7-5-14)23-24(22(27)20-12-15(2)16(3)13-21(20)31-23)32-25(28)18-8-10-19(11-9-18)26(29)30/h4-13H,1-3H3 |
| InChIKey | GRPMQQZJQMYHSZ-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 99.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|