C28H20N2O8 — CID 20999477
[6,7-dimethyl-2-(4-methylphenyl)-4-oxochromen-3-yl] 2-(5-nitro-1,3-dioxoisoindol-2-yl)acetate (PubChem CID 20999477) has the molecular formula C28H20N2O8 and a molecular weight of 512.47 g/mol. Its IUPAC name is [6,7-dimethyl-2-(4-methylphenyl)-4-oxochromen-3-yl] 2-(5-nitro-1,3-dioxoisoindol-2-yl)acetate.
| Compound Name | [6,7-dimethyl-2-(4-methylphenyl)-4-oxochromen-3-yl] 2-(5-nitro-1,3-dioxoisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 20999477 |
| Molecular Formula | C28H20N2O8 |
| Molecular Weight | 512.47 g/mol |
| Exact Mass | 512.12 |
| IUPAC Name | [6,7-dimethyl-2-(4-methylphenyl)-4-oxochromen-3-yl] 2-(5-nitro-1,3-dioxoisoindol-2-yl)acetate |
| SMILES | Cc1ccc(-c2oc3cc(C)c(C)cc3c(=O)c2OC(=O)CN2C(=O)c3ccc([N+](=O)[O-])cc3C2=O)cc1 |
| InChI | InChI=1S/C28H20N2O8/c1-14-4-6-17(7-5-14)25-26(24(32)21-10-15(2)16(3)11-22(21)37-25)38-23(31)13-29-27(33)19-9-8-18(30(35)36)12-20(19)28(29)34/h4-12H,13H2,1-3H3 |
| InChIKey | YDJQIGYMNQETKI-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 137.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.47 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|