C21H19N3O10 — CID 108739416
diethyl 2-methyl-5-[[2-(5-nitro-1,3-dioxoisoindol-2-yl)acetyl]amino]furan-3,4-dicarboxylate (PubChem CID 108739416) has the molecular formula C21H19N3O10 and a molecular weight of 473.39 g/mol. Its IUPAC name is diethyl 2-methyl-5-[[2-(5-nitro-1,3-dioxoisoindol-2-yl)acetyl]amino]furan-3,4-dicarboxylate.
| Compound Name | diethyl 2-methyl-5-[[2-(5-nitro-1,3-dioxoisoindol-2-yl)acetyl]amino]furan-3,4-dicarboxylate |
|---|---|
| PubChem CID | 108739416 |
| Molecular Formula | C21H19N3O10 |
| Molecular Weight | 473.39 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | diethyl 2-methyl-5-[[2-(5-nitro-1,3-dioxoisoindol-2-yl)acetyl]amino]furan-3,4-dicarboxylate |
| SMILES | CCOC(=O)c1c(C)oc(NC(=O)CN2C(=O)c3ccc([N+](=O)[O-])cc3C2=O)c1C(=O)OCC |
| InChI | InChI=1S/C21H19N3O10/c1-4-32-20(28)15-10(3)34-17(16(15)21(29)33-5-2)22-14(25)9-23-18(26)12-7-6-11(24(30)31)8-13(12)19(23)27/h6-8H,4-5,9H2,1-3H3,(H,22,25) |
| InChIKey | FSEKPBGXXFQCNE-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 175.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.39 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|