C17H20N4O7 — CID 108574073
butyl N-[2-[[2-(5-nitro-1,3-dioxoisoindol-2-yl)acetyl]amino]ethyl]carbamate (PubChem CID 108574073) has the molecular formula C17H20N4O7 and a molecular weight of 392.37 g/mol. Its IUPAC name is butyl N-[2-[[2-(5-nitro-1,3-dioxoisoindol-2-yl)acetyl]amino]ethyl]carbamate.
| Compound Name | butyl N-[2-[[2-(5-nitro-1,3-dioxoisoindol-2-yl)acetyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 108574073 |
| Molecular Formula | C17H20N4O7 |
| Molecular Weight | 392.37 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | butyl N-[2-[[2-(5-nitro-1,3-dioxoisoindol-2-yl)acetyl]amino]ethyl]carbamate |
| SMILES | CCCCOC(=O)NCCNC(=O)CN1C(=O)c2ccc([N+](=O)[O-])cc2C1=O |
| InChI | InChI=1S/C17H20N4O7/c1-2-3-8-28-17(25)19-7-6-18-14(22)10-20-15(23)12-5-4-11(21(26)27)9-13(12)16(20)24/h4-5,9H,2-3,6-8,10H2,1H3,(H,18,22)(H,19,25) |
| InChIKey | FFHCLJPTZQYJAW-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 147.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.37 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|