C16H20N4O7S — CID 108574053
N-[2-(butylsulfonylamino)ethyl]-2-(5-nitro-1,3-dioxoisoindol-2-yl)acetamide (PubChem CID 108574053) has the molecular formula C16H20N4O7S and a molecular weight of 412.42 g/mol. Its IUPAC name is N-[2-(butylsulfonylamino)ethyl]-2-(5-nitro-1,3-dioxoisoindol-2-yl)acetamide.
| Compound Name | N-[2-(butylsulfonylamino)ethyl]-2-(5-nitro-1,3-dioxoisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 108574053 |
| Molecular Formula | C16H20N4O7S |
| Molecular Weight | 412.42 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | N-[2-(butylsulfonylamino)ethyl]-2-(5-nitro-1,3-dioxoisoindol-2-yl)acetamide |
| SMILES | CCCCS(=O)(=O)NCCNC(=O)CN1C(=O)c2ccc([N+](=O)[O-])cc2C1=O |
| InChI | InChI=1S/C16H20N4O7S/c1-2-3-8-28(26,27)18-7-6-17-14(21)10-19-15(22)12-5-4-11(20(24)25)9-13(12)16(19)23/h4-5,9,18H,2-3,6-8,10H2,1H3,(H,17,21) |
| InChIKey | VAEOKKLKGXKOLP-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 155.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.42 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|