C17H18N6O7S — CID 108574055
N-[2-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonylamino]ethyl]-2-(5-nitro-1,3-dioxoisoindol-2-yl)acetamide (PubChem CID 108574055) has the molecular formula C17H18N6O7S and a molecular weight of 450.43 g/mol. Its IUPAC name is N-[2-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonylamino]ethyl]-2-(5-nitro-1,3-dioxoisoindol-2-yl)acetamide.
| Compound Name | N-[2-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonylamino]ethyl]-2-(5-nitro-1,3-dioxoisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 108574055 |
| Molecular Formula | C17H18N6O7S |
| Molecular Weight | 450.43 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | N-[2-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonylamino]ethyl]-2-(5-nitro-1,3-dioxoisoindol-2-yl)acetamide |
| SMILES | Cc1n[nH]c(C)c1S(=O)(=O)NCCNC(=O)CN1C(=O)c2ccc([N+](=O)[O-])cc2C1=O |
| InChI | InChI=1S/C17H18N6O7S/c1-9-15(10(2)21-20-9)31(29,30)19-6-5-18-14(24)8-22-16(25)12-4-3-11(23(27)28)7-13(12)17(22)26/h3-4,7,19H,5-6,8H2,1-2H3,(H,18,24)(H,20,21) |
| InChIKey | DZGNVDOYLBANBW-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 184.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.43 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|