C12H14N4O4S — CID 43398044
3,5-dimethyl-N-(2-methyl-5-nitrophenyl)-1H-pyrazole-4-sulfonamide (PubChem CID 43398044) has the molecular formula C12H14N4O4S and a molecular weight of 310.34 g/mol. Its IUPAC name is 3,5-dimethyl-N-(2-methyl-5-nitrophenyl)-1H-pyrazole-4-sulfonamide.
| Compound Name | 3,5-dimethyl-N-(2-methyl-5-nitrophenyl)-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 43398044 |
| Molecular Formula | C12H14N4O4S |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 3,5-dimethyl-N-(2-methyl-5-nitrophenyl)-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NS(=O)(=O)c1c(C)n[nH]c1C |
| InChI | InChI=1S/C12H14N4O4S/c1-7-4-5-10(16(17)18)6-11(7)15-21(19,20)12-8(2)13-14-9(12)3/h4-6,15H,1-3H3,(H,13,14) |
| InChIKey | LSSRXOIDNNMCFC-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 117.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|