C12H14N4O4S — CID 43348964
N,3,5-trimethyl-N-(4-nitrophenyl)-1H-pyrazole-4-sulfonamide (PubChem CID 43348964) has the molecular formula C12H14N4O4S and a molecular weight of 310.33 g/mol. Its IUPAC name is N,3,5-trimethyl-N-(4-nitrophenyl)-1H-pyrazole-4-sulfonamide.
| Compound Name | N,3,5-trimethyl-N-(4-nitrophenyl)-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 43348964 |
| Molecular Formula | C12H14N4O4S |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | N,3,5-trimethyl-N-(4-nitrophenyl)-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1n[nH]c(C)c1S(=O)(=O)N(C)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H14N4O4S/c1-8-12(9(2)14-13-8)21(19,20)15(3)10-4-6-11(7-5-10)16(17)18/h4-7H,1-3H3,(H,13,14) |
| InChIKey | CPUWSQIEUJIANQ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 109.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|