C11H12N4O4S2 — CID 63945983
2-amino-N,4-dimethyl-N-(4-nitrophenyl)-1,3-thiazole-5-sulfonamide (PubChem CID 63945983) has the molecular formula C11H12N4O4S2 and a molecular weight of 328.38 g/mol. Its IUPAC name is 2-amino-N,4-dimethyl-N-(4-nitrophenyl)-1,3-thiazole-5-sulfonamide.
| Compound Name | 2-amino-N,4-dimethyl-N-(4-nitrophenyl)-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 63945983 |
| Molecular Formula | C11H12N4O4S2 |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | 2-amino-N,4-dimethyl-N-(4-nitrophenyl)-1,3-thiazole-5-sulfonamide |
| SMILES | Cc1nc(N)sc1S(=O)(=O)N(C)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H12N4O4S2/c1-7-10(20-11(12)13-7)21(18,19)14(2)8-3-5-9(6-4-8)15(16)17/h3-6H,1-2H3,(H2,12,13) |
| InChIKey | OXYHOFSIKMVNBF-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 119.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|