C12H14N6O4S — CID 146048896
2-amino-5-[(4-nitrophenyl)diazenyl]-1,3-thiazol-4-ol;N,N-dimethylformamide (PubChem CID 146048896) has the molecular formula C12H14N6O4S and a molecular weight of 338.35 g/mol. Its IUPAC name is 2-amino-5-[(4-nitrophenyl)diazenyl]-1,3-thiazol-4-ol;N,N-dimethylformamide.
| Compound Name | 2-amino-5-[(4-nitrophenyl)diazenyl]-1,3-thiazol-4-ol;N,N-dimethylformamide |
|---|---|
| PubChem CID | 146048896 |
| Molecular Formula | C12H14N6O4S |
| Molecular Weight | 338.35 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 2-amino-5-[(4-nitrophenyl)diazenyl]-1,3-thiazol-4-ol;N,N-dimethylformamide |
| SMILES | CN(C)C=O.Nc1nc(O)c(/N=N/c2ccc([N+](=O)[O-])cc2)s1 |
| InChI | InChI=1S/C9H7N5O3S.C3H7NO/c10-9-11-7(15)8(18-9)13-12-5-1-3-6(4-2-5)14(16)17;1-4(2)3-5/h1-4,15H,(H2,10,11);3H,1-2H3/b13-12+; |
| InChIKey | SZIXXWDJYBAAFZ-UEIGIMKUSA-N |
| XLogP | 2.46 |
| TPSA | 147.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.35 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|