C34H28N8O4S4 — CID 10723711
2-[4-[[4-[[4-(dimethylamino)-5-(4-nitrophenyl)-1,3-dithiol-2-ylidene]amino]phenyl]diazenyl]phenyl]imino-N,N-dimethyl-5-(4-nitrophenyl)-1,3-dithiol-4-amine (PubChem CID 10723711) has the molecular formula C34H28N8O4S4 and a molecular weight of 740.92 g/mol. Its IUPAC name is 2-[4-[[4-[[4-(dimethylamino)-5-(4-nitrophenyl)-1,3-dithiol-2-ylidene]amino]phenyl]diazenyl]phenyl]imino-N,N-dimethyl-5-(4-nitrophenyl)-1,3-dithiol-4-amine.
| Compound Name | 2-[4-[[4-[[4-(dimethylamino)-5-(4-nitrophenyl)-1,3-dithiol-2-ylidene]amino]phenyl]diazenyl]phenyl]imino-N,N-dimethyl-5-(4-nitrophenyl)-1,3-dithiol-4-amine |
|---|---|
| PubChem CID | 10723711 |
| Molecular Formula | C34H28N8O4S4 |
| Molecular Weight | 740.92 g/mol |
| Exact Mass | 740.11 |
| IUPAC Name | 2-[4-[[4-[[4-(dimethylamino)-5-(4-nitrophenyl)-1,3-dithiol-2-ylidene]amino]phenyl]diazenyl]phenyl]imino-N,N-dimethyl-5-(4-nitrophenyl)-1,3-dithiol-4-amine |
| SMILES | CN(C)c1s/c(=N\c2ccc(/N=N/c3ccc(/N=c4/sc(-c5ccc([N+](=O)[O-])cc5)c(N(C)C)s4)cc3)cc2)sc1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C34H28N8O4S4/c1-39(2)31-29(21-5-17-27(18-6-21)41(43)44)47-33(49-31)35-23-9-13-25(14-10-23)37-38-26-15-11-24(12-16-26)36-34-48-30(32(50-34)40(3)4)22-7-19-28(20-8-22)42(45)46/h5-20H,1-4H3/b35-33-,36-34-,38-37+ |
| InChIKey | XQHWCTKKPKJZJF-ZTYOBMKYSA-N |
| XLogP | 10.10 |
| TPSA | 142.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.92 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|