C19H19N3O2S2 — CID 10738867
2-(2,6-dimethylphenyl)imino-N,N-dimethyl-5-(4-nitrophenyl)-1,3-dithiol-4-amine (PubChem CID 10738867) has the molecular formula C19H19N3O2S2 and a molecular weight of 385.51 g/mol. Its IUPAC name is 2-(2,6-dimethylphenyl)imino-N,N-dimethyl-5-(4-nitrophenyl)-1,3-dithiol-4-amine.
| Compound Name | 2-(2,6-dimethylphenyl)imino-N,N-dimethyl-5-(4-nitrophenyl)-1,3-dithiol-4-amine |
|---|---|
| PubChem CID | 10738867 |
| Molecular Formula | C19H19N3O2S2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | 2-(2,6-dimethylphenyl)imino-N,N-dimethyl-5-(4-nitrophenyl)-1,3-dithiol-4-amine |
| SMILES | Cc1cccc(C)c1/N=c1/sc(-c2ccc([N+](=O)[O-])cc2)c(N(C)C)s1 |
| InChI | InChI=1S/C19H19N3O2S2/c1-12-6-5-7-13(2)16(12)20-19-25-17(18(26-19)21(3)4)14-8-10-15(11-9-14)22(23)24/h5-11H,1-4H3/b20-19- |
| InChIKey | AIWOLLREJCRAOZ-VXPUYCOJSA-N |
| XLogP | 5.30 |
| TPSA | 58.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|