C14H11NO2S2 — CID 135037493
3,4-dimethyl-5-(4-nitrophenyl)thieno[2,3-b]thiophene (PubChem CID 135037493) has the molecular formula C14H11NO2S2 and a molecular weight of 289.38 g/mol. Its IUPAC name is 3,4-dimethyl-5-(4-nitrophenyl)thieno[2,3-b]thiophene.
| Compound Name | 3,4-dimethyl-5-(4-nitrophenyl)thieno[2,3-b]thiophene |
|---|---|
| PubChem CID | 135037493 |
| Molecular Formula | C14H11NO2S2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | 3,4-dimethyl-5-(4-nitrophenyl)thieno[2,3-b]thiophene |
| SMILES | Cc1csc2sc(-c3ccc([N+](=O)[O-])cc3)c(C)c12 |
| InChI | InChI=1S/C14H11NO2S2/c1-8-7-18-14-12(8)9(2)13(19-14)10-3-5-11(6-4-10)15(16)17/h3-7H,1-2H3 |
| InChIKey | JPHNGCVMIGFYMS-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|