C12H12N2O2S — CID 82366104
4,5-dimethyl-3-(4-nitrophenyl)thiophen-2-amine (PubChem CID 82366104) has the molecular formula C12H12N2O2S and a molecular weight of 248.31 g/mol. Its IUPAC name is 4,5-dimethyl-3-(4-nitrophenyl)thiophen-2-amine.
| Compound Name | 4,5-dimethyl-3-(4-nitrophenyl)thiophen-2-amine |
|---|---|
| PubChem CID | 82366104 |
| Molecular Formula | C12H12N2O2S |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 4,5-dimethyl-3-(4-nitrophenyl)thiophen-2-amine |
| SMILES | Cc1sc(N)c(-c2ccc([N+](=O)[O-])cc2)c1C |
| InChI | InChI=1S/C12H12N2O2S/c1-7-8(2)17-12(13)11(7)9-3-5-10(6-4-9)14(15)16/h3-6H,13H2,1-2H3 |
| InChIKey | YTQNSAIGDNGXAV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|