C11H10N2O2S — CID 67621456
2,5-dimethyl-4-(4-nitrophenyl)-1,3-thiazole (PubChem CID 67621456) has the molecular formula C11H10N2O2S and a molecular weight of 234.28 g/mol. Its IUPAC name is 2,5-dimethyl-4-(4-nitrophenyl)-1,3-thiazole.
| Compound Name | 2,5-dimethyl-4-(4-nitrophenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 67621456 |
| Molecular Formula | C11H10N2O2S |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 2,5-dimethyl-4-(4-nitrophenyl)-1,3-thiazole |
| SMILES | Cc1nc(-c2ccc([N+](=O)[O-])cc2)c(C)s1 |
| InChI | InChI=1S/C11H10N2O2S/c1-7-11(12-8(2)16-7)9-3-5-10(6-4-9)13(14)15/h3-6H,1-2H3 |
| InChIKey | JCJMXDKCOUHXGW-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|