C9H7N3O3 — CID 13144101
3-methyl-4-(4-nitrophenyl)-1,2,5-oxadiazole (PubChem CID 13144101) has the molecular formula C9H7N3O3 and a molecular weight of 205.17 g/mol. Its IUPAC name is 3-methyl-4-(4-nitrophenyl)-1,2,5-oxadiazole.
| Compound Name | 3-methyl-4-(4-nitrophenyl)-1,2,5-oxadiazole |
|---|---|
| PubChem CID | 13144101 |
| Molecular Formula | C9H7N3O3 |
| Molecular Weight | 205.17 g/mol |
| Exact Mass | 205.05 |
| IUPAC Name | 3-methyl-4-(4-nitrophenyl)-1,2,5-oxadiazole |
| SMILES | Cc1nonc1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C9H7N3O3/c1-6-9(11-15-10-6)7-2-4-8(5-3-7)12(13)14/h2-5H,1H3 |
| InChIKey | JSPGTMCQQICOFH-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 82.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.17 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|