C13H16N2O3Si — CID 158258419
trimethyl-[4-methyl-3-(4-nitrophenyl)-1,2-oxazol-5-yl]silane (PubChem CID 158258419) has the molecular formula C13H16N2O3Si and a molecular weight of 276.37 g/mol. Its IUPAC name is trimethyl-[4-methyl-3-(4-nitrophenyl)-1,2-oxazol-5-yl]silane.
| Compound Name | trimethyl-[4-methyl-3-(4-nitrophenyl)-1,2-oxazol-5-yl]silane |
|---|---|
| PubChem CID | 158258419 |
| Molecular Formula | C13H16N2O3Si |
| Molecular Weight | 276.37 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | trimethyl-[4-methyl-3-(4-nitrophenyl)-1,2-oxazol-5-yl]silane |
| SMILES | Cc1c(-c2ccc([N+](=O)[O-])cc2)noc1[Si](C)(C)C |
| InChI | InChI=1S/C13H16N2O3Si/c1-9-12(14-18-13(9)19(2,3)4)10-5-7-11(8-6-10)15(16)17/h5-8H,1-4H3 |
| InChIKey | YHXMEVQBDPDOEK-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 69.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|