C18H16N2O4 — CID 131867820
[5-(3,5-dimethylphenyl)-3-(4-nitrophenyl)-1,2-oxazol-4-yl]methanol (PubChem CID 131867820) has the molecular formula C18H16N2O4 and a molecular weight of 324.34 g/mol. Its IUPAC name is [5-(3,5-dimethylphenyl)-3-(4-nitrophenyl)-1,2-oxazol-4-yl]methanol.
| Compound Name | [5-(3,5-dimethylphenyl)-3-(4-nitrophenyl)-1,2-oxazol-4-yl]methanol |
|---|---|
| PubChem CID | 131867820 |
| Molecular Formula | C18H16N2O4 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | [5-(3,5-dimethylphenyl)-3-(4-nitrophenyl)-1,2-oxazol-4-yl]methanol |
| SMILES | Cc1cc(C)cc(-c2onc(-c3ccc([N+](=O)[O-])cc3)c2CO)c1 |
| InChI | InChI=1S/C18H16N2O4/c1-11-7-12(2)9-14(8-11)18-16(10-21)17(19-24-18)13-3-5-15(6-4-13)20(22)23/h3-9,21H,10H2,1-2H3 |
| InChIKey | ZXPVHKKVCNKKQY-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 89.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|