About [5-(3,5-dichlorophenyl)-3-(2-nitrophenyl)-1,2-oxazol-4-yl]methanol
[5-(3,5-dichlorophenyl)-3-(2-nitrophenyl)-1,2-oxazol-4-yl]methanol (PubChem CID 131866916) has the molecular formula C16H10Cl2N2O4
and a molecular weight of 365.17 g/mol. Its IUPAC name is [5-(3,5-dichlorophenyl)-3-(2-nitrophenyl)-1,2-oxazol-4-yl]methanol.
Molecular Properties
| Compound Name | [5-(3,5-dichlorophenyl)-3-(2-nitrophenyl)-1,2-oxazol-4-yl]methanol |
| PubChem CID | 131866916 |
| Molecular Formula | C16H10Cl2N2O4 |
| Molecular Weight | 365.17 g/mol |
| Exact Mass | 364.00 |
| IUPAC Name | [5-(3,5-dichlorophenyl)-3-(2-nitrophenyl)-1,2-oxazol-4-yl]methanol |
| SMILES | O=[N+]([O-])c1ccccc1-c1noc(-c2cc(Cl)cc(Cl)c2)c1CO |
| InChI | InChI=1S/C16H10Cl2N2O4/c17-10-5-9(6-11(18)7-10)16-13(8-21)15(19-24-16)12-3-1-2-4-14(12)20(22)23/h1-7,21H,8H2 |
| InChIKey | BZQSIADIWJNFEE-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 89.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.17 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [5-(3,5-dichlorophenyl)-3-(2-nitrophenyl)-1,2-oxazol-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(3,5-dichlorophenyl)-3-(2-nitrophenyl)-1,2-oxazol-4-yl]methanol?
The IUPAC name of [5-(3,5-dichlorophenyl)-3-(2-nitrophenyl)-1,2-oxazol-4-yl]methanol (CID 131866916) is [5-(3,5-dichlorophenyl)-3-(2-nitrophenyl)-1,2-oxazol-4-yl]methanol.
What is the SMILES notation for [5-(3,5-dichlorophenyl)-3-(2-nitrophenyl)-1,2-oxazol-4-yl]methanol?
The canonical SMILES for [5-(3,5-dichlorophenyl)-3-(2-nitrophenyl)-1,2-oxazol-4-yl]methanol is O=[N+]([O-])c1ccccc1-c1noc(-c2cc(Cl)cc(Cl)c2)c1CO.
What is the InChIKey of [5-(3,5-dichlorophenyl)-3-(2-nitrophenyl)-1,2-oxazol-4-yl]methanol?
The InChIKey is BZQSIADIWJNFEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10Cl2N2O4/c17-10-5-9(6-11(18)7-10)16-13(8-21)15(19-24-16)12-3-1-2-4-14(12)20(22)23/h1-7,21H,8H2.
What are the key properties of [5-(3,5-dichlorophenyl)-3-(2-nitrophenyl)-1,2-oxazol-4-yl]methanol?
[5-(3,5-dichlorophenyl)-3-(2-nitrophenyl)-1,2-oxazol-4-yl]methanol has a molecular weight of 365.17 g/mol, XLogP of 4.72, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(3,5-dichlorophenyl)-3-(2-nitrophenyl)-1,2-oxazol-4-yl]methanol is sourced from PubChem (CID 131866916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).