C16H10Cl2N2O4 — CID 131868525
[3-(2,5-dichlorophenyl)-5-(2-nitrophenyl)-1,2-oxazol-4-yl]methanol (PubChem CID 131868525) has the molecular formula C16H10Cl2N2O4 and a molecular weight of 365.17 g/mol. Its IUPAC name is [3-(2,5-dichlorophenyl)-5-(2-nitrophenyl)-1,2-oxazol-4-yl]methanol.
| Compound Name | [3-(2,5-dichlorophenyl)-5-(2-nitrophenyl)-1,2-oxazol-4-yl]methanol |
|---|---|
| PubChem CID | 131868525 |
| Molecular Formula | C16H10Cl2N2O4 |
| Molecular Weight | 365.17 g/mol |
| Exact Mass | 364.00 |
| IUPAC Name | [3-(2,5-dichlorophenyl)-5-(2-nitrophenyl)-1,2-oxazol-4-yl]methanol |
| SMILES | O=[N+]([O-])c1ccccc1-c1onc(-c2cc(Cl)ccc2Cl)c1CO |
| InChI | InChI=1S/C16H10Cl2N2O4/c17-9-5-6-13(18)11(7-9)15-12(8-21)16(24-19-15)10-3-1-2-4-14(10)20(22)23/h1-7,21H,8H2 |
| InChIKey | SULZVUHLRCVKRF-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 89.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.17 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|