C23H21NO3S — CID 14668878
1-(4-methoxyphenyl)-5,6-dimethyl-3-(4-nitrophenyl)-4,7-dihydro-2-benzothiophene (PubChem CID 14668878) has the molecular formula C23H21NO3S and a molecular weight of 391.49 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-5,6-dimethyl-3-(4-nitrophenyl)-4,7-dihydro-2-benzothiophene.
| Compound Name | 1-(4-methoxyphenyl)-5,6-dimethyl-3-(4-nitrophenyl)-4,7-dihydro-2-benzothiophene |
|---|---|
| PubChem CID | 14668878 |
| Molecular Formula | C23H21NO3S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 1-(4-methoxyphenyl)-5,6-dimethyl-3-(4-nitrophenyl)-4,7-dihydro-2-benzothiophene |
| SMILES | COc1ccc(-c2sc(-c3ccc([N+](=O)[O-])cc3)c3c2CC(C)=C(C)C3)cc1 |
| InChI | InChI=1S/C23H21NO3S/c1-14-12-20-21(13-15(14)2)23(17-6-10-19(27-3)11-7-17)28-22(20)16-4-8-18(9-5-16)24(25)26/h4-11H,12-13H2,1-3H3 |
| InChIKey | TWBVALXOHSZVQG-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|