C15H14N2O2S — CID 142318792
4,7-dimethyl-2-(4-nitrophenyl)-5,6-dihydro-1,3-benzothiazole (PubChem CID 142318792) has the molecular formula C15H14N2O2S and a molecular weight of 286.36 g/mol. Its IUPAC name is 4,7-dimethyl-2-(4-nitrophenyl)-5,6-dihydro-1,3-benzothiazole.
| Compound Name | 4,7-dimethyl-2-(4-nitrophenyl)-5,6-dihydro-1,3-benzothiazole |
|---|---|
| PubChem CID | 142318792 |
| Molecular Formula | C15H14N2O2S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 4,7-dimethyl-2-(4-nitrophenyl)-5,6-dihydro-1,3-benzothiazole |
| SMILES | CC1=c2nc(-c3ccc([N+](=O)[O-])cc3)sc2=C(C)CC1 |
| InChI | InChI=1S/C15H14N2O2S/c1-9-3-4-10(2)14-13(9)16-15(20-14)11-5-7-12(8-6-11)17(18)19/h5-8H,3-4H2,1-2H3 |
| InChIKey | BIWWZSJBONBEPB-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|