C10H6N2O4S — CID 135802594
4-hydroxy-2-(4-nitrophenyl)-1,3-thiazin-6-one (PubChem CID 135802594) has the molecular formula C10H6N2O4S and a molecular weight of 250.24 g/mol. Its IUPAC name is 4-hydroxy-2-(4-nitrophenyl)-1,3-thiazin-6-one.
| Compound Name | 4-hydroxy-2-(4-nitrophenyl)-1,3-thiazin-6-one |
|---|---|
| PubChem CID | 135802594 |
| Molecular Formula | C10H6N2O4S |
| Molecular Weight | 250.24 g/mol |
| Exact Mass | 250.00 |
| IUPAC Name | 4-hydroxy-2-(4-nitrophenyl)-1,3-thiazin-6-one |
| SMILES | O=c1cc(O)nc(-c2ccc([N+](=O)[O-])cc2)s1 |
| InChI | InChI=1S/C10H6N2O4S/c13-8-5-9(14)17-10(11-8)6-1-3-7(4-2-6)12(15)16/h1-5,13H |
| InChIKey | CUSDNFFUZMRSEL-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 93.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.24 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|