C17H12N2O6S — CID 135856037
4-hydroxy-2-phenyl-1,3-thiazin-6-one;4-nitrobenzoic acid (PubChem CID 135856037) has the molecular formula C17H12N2O6S and a molecular weight of 372.36 g/mol. Its IUPAC name is 4-hydroxy-2-phenyl-1,3-thiazin-6-one;4-nitrobenzoic acid.
| Compound Name | 4-hydroxy-2-phenyl-1,3-thiazin-6-one;4-nitrobenzoic acid |
|---|---|
| PubChem CID | 135856037 |
| Molecular Formula | C17H12N2O6S |
| Molecular Weight | 372.36 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | 4-hydroxy-2-phenyl-1,3-thiazin-6-one;4-nitrobenzoic acid |
| SMILES | O=C(O)c1ccc([N+](=O)[O-])cc1.O=c1cc(O)nc(-c2ccccc2)s1 |
| InChI | InChI=1S/C10H7NO2S.C7H5NO4/c12-8-6-9(13)14-10(11-8)7-4-2-1-3-5-7;9-7(10)5-1-3-6(4-2-5)8(11)12/h1-6,12H;1-4H,(H,9,10) |
| InChIKey | KGRZZJPUKHLQDX-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 130.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.36 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|