C17H9F3N2O3S — CID 162692056
(4-nitrophenyl)-[3-phenyl-5-(trifluoromethyl)-1,2-thiazol-4-yl]methanone (PubChem CID 162692056) has the molecular formula C17H9F3N2O3S and a molecular weight of 378.33 g/mol. Its IUPAC name is (4-nitrophenyl)-[3-phenyl-5-(trifluoromethyl)-1,2-thiazol-4-yl]methanone.
| Compound Name | (4-nitrophenyl)-[3-phenyl-5-(trifluoromethyl)-1,2-thiazol-4-yl]methanone |
|---|---|
| PubChem CID | 162692056 |
| Molecular Formula | C17H9F3N2O3S |
| Molecular Weight | 378.33 g/mol |
| Exact Mass | 378.03 |
| IUPAC Name | (4-nitrophenyl)-[3-phenyl-5-(trifluoromethyl)-1,2-thiazol-4-yl]methanone |
| SMILES | O=C(c1ccc([N+](=O)[O-])cc1)c1c(-c2ccccc2)nsc1C(F)(F)F |
| InChI | InChI=1S/C17H9F3N2O3S/c18-17(19,20)16-13(14(21-26-16)10-4-2-1-3-5-10)15(23)11-6-8-12(9-7-11)22(24)25/h1-9H |
| InChIKey | QXYXSULLHSKAHK-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 73.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.33 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|