About (4-methoxyphenyl)-[3-phenyl-5-(trifluoromethyl)-1,2-thiazol-4-yl]methanone
(4-methoxyphenyl)-[3-phenyl-5-(trifluoromethyl)-1,2-thiazol-4-yl]methanone (PubChem CID 162692086) has the molecular formula C18H12F3NO2S
and a molecular weight of 363.36 g/mol. Its IUPAC name is (4-methoxyphenyl)-[3-phenyl-5-(trifluoromethyl)-1,2-thiazol-4-yl]methanone.
Molecular Properties
| Compound Name | (4-methoxyphenyl)-[3-phenyl-5-(trifluoromethyl)-1,2-thiazol-4-yl]methanone |
| PubChem CID | 162692086 |
| Molecular Formula | C18H12F3NO2S |
| Molecular Weight | 363.36 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | (4-methoxyphenyl)-[3-phenyl-5-(trifluoromethyl)-1,2-thiazol-4-yl]methanone |
| SMILES | COc1ccc(C(=O)c2c(-c3ccccc3)nsc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H12F3NO2S/c1-24-13-9-7-12(8-10-13)16(23)14-15(11-5-3-2-4-6-11)22-25-17(14)18(19,20)21/h2-10H,1H3 |
| InChIKey | QLHLHXAUDRDAGR-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 363.36 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-methoxyphenyl)-[3-phenyl-5-(trifluoromethyl)-1,2-thiazol-4-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxyphenyl)-[3-phenyl-5-(trifluoromethyl)-1,2-thiazol-4-yl]methanone?
The IUPAC name of (4-methoxyphenyl)-[3-phenyl-5-(trifluoromethyl)-1,2-thiazol-4-yl]methanone (CID 162692086) is (4-methoxyphenyl)-[3-phenyl-5-(trifluoromethyl)-1,2-thiazol-4-yl]methanone.
What is the SMILES notation for (4-methoxyphenyl)-[3-phenyl-5-(trifluoromethyl)-1,2-thiazol-4-yl]methanone?
The canonical SMILES for (4-methoxyphenyl)-[3-phenyl-5-(trifluoromethyl)-1,2-thiazol-4-yl]methanone is COc1ccc(C(=O)c2c(-c3ccccc3)nsc2C(F)(F)F)cc1.
What is the InChIKey of (4-methoxyphenyl)-[3-phenyl-5-(trifluoromethyl)-1,2-thiazol-4-yl]methanone?
The InChIKey is QLHLHXAUDRDAGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12F3NO2S/c1-24-13-9-7-12(8-10-13)16(23)14-15(11-5-3-2-4-6-11)22-25-17(14)18(19,20)21/h2-10H,1H3.
What are the key properties of (4-methoxyphenyl)-[3-phenyl-5-(trifluoromethyl)-1,2-thiazol-4-yl]methanone?
(4-methoxyphenyl)-[3-phenyl-5-(trifluoromethyl)-1,2-thiazol-4-yl]methanone has a molecular weight of 363.36 g/mol, XLogP of 5.07, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxyphenyl)-[3-phenyl-5-(trifluoromethyl)-1,2-thiazol-4-yl]methanone is sourced from PubChem (CID 162692086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).