C11H8BrNO2S — CID 121006068
methyl 5-bromo-3-phenyl-1,2-thiazole-4-carboxylate (PubChem CID 121006068) has the molecular formula C11H8BrNO2S and a molecular weight of 298.16 g/mol. Its IUPAC name is methyl 5-bromo-3-phenyl-1,2-thiazole-4-carboxylate.
| Compound Name | methyl 5-bromo-3-phenyl-1,2-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 121006068 |
| Molecular Formula | C11H8BrNO2S |
| Molecular Weight | 298.16 g/mol |
| Exact Mass | 296.95 |
| IUPAC Name | methyl 5-bromo-3-phenyl-1,2-thiazole-4-carboxylate |
| SMILES | COC(=O)c1c(-c2ccccc2)nsc1Br |
| InChI | InChI=1S/C11H8BrNO2S/c1-15-11(14)8-9(13-16-10(8)12)7-5-3-2-4-6-7/h2-6H,1H3 |
| InChIKey | XKWSWXXNOQLEPX-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.16 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |