C19H13Cl3N2O2 — CID 134914814
methyl 4,6-diphenyl-2-(trichloromethyl)pyrimidine-5-carboxylate (PubChem CID 134914814) has the molecular formula C19H13Cl3N2O2 and a molecular weight of 407.68 g/mol. Its IUPAC name is methyl 4,6-diphenyl-2-(trichloromethyl)pyrimidine-5-carboxylate.
| Compound Name | methyl 4,6-diphenyl-2-(trichloromethyl)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 134914814 |
| Molecular Formula | C19H13Cl3N2O2 |
| Molecular Weight | 407.68 g/mol |
| Exact Mass | 406.00 |
| IUPAC Name | methyl 4,6-diphenyl-2-(trichloromethyl)pyrimidine-5-carboxylate |
| SMILES | COC(=O)c1c(-c2ccccc2)nc(C(Cl)(Cl)Cl)nc1-c1ccccc1 |
| InChI | InChI=1S/C19H13Cl3N2O2/c1-26-17(25)14-15(12-8-4-2-5-9-12)23-18(19(20,21)22)24-16(14)13-10-6-3-7-11-13/h2-11H,1H3 |
| InChIKey | QXOJPOBCCRDUNJ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.68 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|