C13H7Cl6N3O2 — CID 14572905
methyl 3-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]benzoate (PubChem CID 14572905) has the molecular formula C13H7Cl6N3O2 and a molecular weight of 449.94 g/mol. Its IUPAC name is methyl 3-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]benzoate.
| Compound Name | methyl 3-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]benzoate |
|---|---|
| PubChem CID | 14572905 |
| Molecular Formula | C13H7Cl6N3O2 |
| Molecular Weight | 449.94 g/mol |
| Exact Mass | 446.87 |
| IUPAC Name | methyl 3-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]benzoate |
| SMILES | COC(=O)c1cccc(-c2nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n2)c1 |
| InChI | InChI=1S/C13H7Cl6N3O2/c1-24-9(23)7-4-2-3-6(5-7)8-20-10(12(14,15)16)22-11(21-8)13(17,18)19/h2-5H,1H3 |
| InChIKey | STQVNUGBZXDIBK-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 64.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.94 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|