C14H10Cl6N4O4S — CID 89198463
2-[[3-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]benzoyl]amino]ethanesulfonic acid (PubChem CID 89198463) has the molecular formula C14H10Cl6N4O4S and a molecular weight of 543.04 g/mol. Its IUPAC name is 2-[[3-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]benzoyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[3-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]benzoyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 89198463 |
| Molecular Formula | C14H10Cl6N4O4S |
| Molecular Weight | 543.04 g/mol |
| Exact Mass | 539.86 |
| IUPAC Name | 2-[[3-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]benzoyl]amino]ethanesulfonic acid |
| SMILES | O=C(NCCS(=O)(=O)O)c1cccc(-c2nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n2)c1 |
| InChI | InChI=1S/C14H10Cl6N4O4S/c15-13(16,17)11-22-9(23-12(24-11)14(18,19)20)7-2-1-3-8(6-7)10(25)21-4-5-29(26,27)28/h1-3,6H,4-5H2,(H,21,25)(H,26,27,28) |
| InChIKey | ITZYFVFLMAZSCD-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 122.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.04 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|