C19H24N4O3S — CID 122562480
N-[2-(methanesulfonamido)ethyl]-3-(4-methyl-5,6,7,8-tetrahydroquinazolin-2-yl)benzamide (PubChem CID 122562480) has the molecular formula C19H24N4O3S and a molecular weight of 388.49 g/mol. Its IUPAC name is N-[2-(methanesulfonamido)ethyl]-3-(4-methyl-5,6,7,8-tetrahydroquinazolin-2-yl)benzamide.
| Compound Name | N-[2-(methanesulfonamido)ethyl]-3-(4-methyl-5,6,7,8-tetrahydroquinazolin-2-yl)benzamide |
|---|---|
| PubChem CID | 122562480 |
| Molecular Formula | C19H24N4O3S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | N-[2-(methanesulfonamido)ethyl]-3-(4-methyl-5,6,7,8-tetrahydroquinazolin-2-yl)benzamide |
| SMILES | Cc1nc(-c2cccc(C(=O)NCCNS(C)(=O)=O)c2)nc2c1CCCC2 |
| InChI | InChI=1S/C19H24N4O3S/c1-13-16-8-3-4-9-17(16)23-18(22-13)14-6-5-7-15(12-14)19(24)20-10-11-21-27(2,25)26/h5-7,12,21H,3-4,8-11H2,1-2H3,(H,20,24) |
| InChIKey | MDENBSSCGDVYGR-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|