C16H21N5O3S — CID 122566280
3-[6-(dimethylamino)pyrazin-2-yl]-N-[2-(methanesulfonamido)ethyl]benzamide (PubChem CID 122566280) has the molecular formula C16H21N5O3S and a molecular weight of 363.44 g/mol. Its IUPAC name is 3-[6-(dimethylamino)pyrazin-2-yl]-N-[2-(methanesulfonamido)ethyl]benzamide.
| Compound Name | 3-[6-(dimethylamino)pyrazin-2-yl]-N-[2-(methanesulfonamido)ethyl]benzamide |
|---|---|
| PubChem CID | 122566280 |
| Molecular Formula | C16H21N5O3S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 3-[6-(dimethylamino)pyrazin-2-yl]-N-[2-(methanesulfonamido)ethyl]benzamide |
| SMILES | CN(C)c1cncc(-c2cccc(C(=O)NCCNS(C)(=O)=O)c2)n1 |
| InChI | InChI=1S/C16H21N5O3S/c1-21(2)15-11-17-10-14(20-15)12-5-4-6-13(9-12)16(22)18-7-8-19-25(3,23)24/h4-6,9-11,19H,7-8H2,1-3H3,(H,18,22) |
| InChIKey | QZOIMYYIAVZEJX-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|