C29H22N2O2 — CID 10884492
(4-methoxyphenyl)-(1,3,5-triphenylpyrazol-4-yl)methanone (PubChem CID 10884492) has the molecular formula C29H22N2O2 and a molecular weight of 430.51 g/mol. Its IUPAC name is (4-methoxyphenyl)-(1,3,5-triphenylpyrazol-4-yl)methanone.
| Compound Name | (4-methoxyphenyl)-(1,3,5-triphenylpyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 10884492 |
| Molecular Formula | C29H22N2O2 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | (4-methoxyphenyl)-(1,3,5-triphenylpyrazol-4-yl)methanone |
| SMILES | COc1ccc(C(=O)c2c(-c3ccccc3)nn(-c3ccccc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C29H22N2O2/c1-33-25-19-17-23(18-20-25)29(32)26-27(21-11-5-2-6-12-21)30-31(24-15-9-4-10-16-24)28(26)22-13-7-3-8-14-22/h2-20H,1H3 |
| InChIKey | KJCDXCIWEQFESD-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |