C24H22N2O — CID 10808049
4-ethyl-1-(4-methoxyphenyl)-3,5-diphenylpyrazole (PubChem CID 10808049) has the molecular formula C24H22N2O and a molecular weight of 354.45 g/mol. Its IUPAC name is 4-ethyl-1-(4-methoxyphenyl)-3,5-diphenylpyrazole.
| Compound Name | 4-ethyl-1-(4-methoxyphenyl)-3,5-diphenylpyrazole |
|---|---|
| PubChem CID | 10808049 |
| Molecular Formula | C24H22N2O |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 4-ethyl-1-(4-methoxyphenyl)-3,5-diphenylpyrazole |
| SMILES | CCc1c(-c2ccccc2)nn(-c2ccc(OC)cc2)c1-c1ccccc1 |
| InChI | InChI=1S/C24H22N2O/c1-3-22-23(18-10-6-4-7-11-18)25-26(20-14-16-21(27-2)17-15-20)24(22)19-12-8-5-9-13-19/h4-17H,3H2,1-2H3 |
| InChIKey | ARMLGJTXBWNMFV-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |