C29H22N2O — CID 15197844
(4-methylphenyl)-(1,3,5-triphenylpyrazol-4-yl)methanone (PubChem CID 15197844) has the molecular formula C29H22N2O and a molecular weight of 414.51 g/mol. Its IUPAC name is (4-methylphenyl)-(1,3,5-triphenylpyrazol-4-yl)methanone.
| Compound Name | (4-methylphenyl)-(1,3,5-triphenylpyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 15197844 |
| Molecular Formula | C29H22N2O |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | (4-methylphenyl)-(1,3,5-triphenylpyrazol-4-yl)methanone |
| SMILES | Cc1ccc(C(=O)c2c(-c3ccccc3)nn(-c3ccccc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C29H22N2O/c1-21-17-19-24(20-18-21)29(32)26-27(22-11-5-2-6-12-22)30-31(25-15-9-4-10-16-25)28(26)23-13-7-3-8-14-23/h2-20H,1H3 |
| InChIKey | YCRRBUHWTRFNPZ-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |